About (2,3-dichlorophenyl)-(1,4-dithian-2-yl)methanone
(2,3-dichlorophenyl)-(1,4-dithian-2-yl)methanone (PubChem CID 79973397) has the molecular formula C11H10Cl2OS2
and a molecular weight of 293.24 g/mol. Its IUPAC name is (2,3-dichlorophenyl)-(1,4-dithian-2-yl)methanone.
Molecular Properties
| Compound Name | (2,3-dichlorophenyl)-(1,4-dithian-2-yl)methanone |
| PubChem CID | 79973397 |
| Molecular Formula | C11H10Cl2OS2 |
| Molecular Weight | 293.24 g/mol |
| Exact Mass | 291.96 |
| IUPAC Name | (2,3-dichlorophenyl)-(1,4-dithian-2-yl)methanone |
| SMILES | O=C(c1cccc(Cl)c1Cl)C1CSCCS1 |
| InChI | InChI=1S/C11H10Cl2OS2/c12-8-3-1-2-7(10(8)13)11(14)9-6-15-4-5-16-9/h1-3,9H,4-6H2 |
| InChIKey | HRXAKDFSSGVVNM-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.24 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2,3-dichlorophenyl)-(1,4-dithian-2-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,3-dichlorophenyl)-(1,4-dithian-2-yl)methanone?
The IUPAC name of (2,3-dichlorophenyl)-(1,4-dithian-2-yl)methanone (CID 79973397) is (2,3-dichlorophenyl)-(1,4-dithian-2-yl)methanone.
What is the SMILES notation for (2,3-dichlorophenyl)-(1,4-dithian-2-yl)methanone?
The canonical SMILES for (2,3-dichlorophenyl)-(1,4-dithian-2-yl)methanone is O=C(c1cccc(Cl)c1Cl)C1CSCCS1.
What is the InChIKey of (2,3-dichlorophenyl)-(1,4-dithian-2-yl)methanone?
The InChIKey is HRXAKDFSSGVVNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10Cl2OS2/c12-8-3-1-2-7(10(8)13)11(14)9-6-15-4-5-16-9/h1-3,9H,4-6H2.
What are the key properties of (2,3-dichlorophenyl)-(1,4-dithian-2-yl)methanone?
(2,3-dichlorophenyl)-(1,4-dithian-2-yl)methanone has a molecular weight of 293.24 g/mol, XLogP of 4.02, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2,3-dichlorophenyl)-(1,4-dithian-2-yl)methanone is sourced from PubChem (CID 79973397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).