C13H12Br2N2OS — CID 79976343
N-(2-amino-4-bromo-6-methylphenyl)-5-bromo-4-methylthiophene-2-carboxamide (PubChem CID 79976343) has the molecular formula C13H12Br2N2OS and a molecular weight of 404.13 g/mol. Its IUPAC name is N-(2-amino-4-bromo-6-methylphenyl)-5-bromo-4-methylthiophene-2-carboxamide.
| Compound Name | N-(2-amino-4-bromo-6-methylphenyl)-5-bromo-4-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 79976343 |
| Molecular Formula | C13H12Br2N2OS |
| Molecular Weight | 404.13 g/mol |
| Exact Mass | 401.90 |
| IUPAC Name | N-(2-amino-4-bromo-6-methylphenyl)-5-bromo-4-methylthiophene-2-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2c(C)cc(Br)cc2N)sc1Br |
| InChI | InChI=1S/C13H12Br2N2OS/c1-6-3-8(14)5-9(16)11(6)17-13(18)10-4-7(2)12(15)19-10/h3-5H,16H2,1-2H3,(H,17,18) |
| InChIKey | SAXAVMHEOJCLJN-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.13 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|