C16H16ClNO2S — CID 79976593
6-[chloro-(3-ethylthiophen-2-yl)methyl]-3-ethyl-1,3-benzoxazol-2-one (PubChem CID 79976593) has the molecular formula C16H16ClNO2S and a molecular weight of 321.83 g/mol. Its IUPAC name is 6-[chloro-(3-ethylthiophen-2-yl)methyl]-3-ethyl-1,3-benzoxazol-2-one.
| Compound Name | 6-[chloro-(3-ethylthiophen-2-yl)methyl]-3-ethyl-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 79976593 |
| Molecular Formula | C16H16ClNO2S |
| Molecular Weight | 321.83 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | 6-[chloro-(3-ethylthiophen-2-yl)methyl]-3-ethyl-1,3-benzoxazol-2-one |
| SMILES | CCc1ccsc1C(Cl)c1ccc2c(c1)oc(=O)n2CC |
| InChI | InChI=1S/C16H16ClNO2S/c1-3-10-7-8-21-15(10)14(17)11-5-6-12-13(9-11)20-16(19)18(12)4-2/h5-9,14H,3-4H2,1-2H3 |
| InChIKey | OMIBZBUAVMTORN-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 35.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.83 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|