C16H17BrO3S — CID 79976793
(5-bromo-4-methylthiophen-2-yl)-(3,4-diethoxyphenyl)methanone (PubChem CID 79976793) has the molecular formula C16H17BrO3S and a molecular weight of 369.28 g/mol. Its IUPAC name is (5-bromo-4-methylthiophen-2-yl)-(3,4-diethoxyphenyl)methanone.
| Compound Name | (5-bromo-4-methylthiophen-2-yl)-(3,4-diethoxyphenyl)methanone |
|---|---|
| PubChem CID | 79976793 |
| Molecular Formula | C16H17BrO3S |
| Molecular Weight | 369.28 g/mol |
| Exact Mass | 368.01 |
| IUPAC Name | (5-bromo-4-methylthiophen-2-yl)-(3,4-diethoxyphenyl)methanone |
| SMILES | CCOc1ccc(C(=O)c2cc(C)c(Br)s2)cc1OCC |
| InChI | InChI=1S/C16H17BrO3S/c1-4-19-12-7-6-11(9-13(12)20-5-2)15(18)14-8-10(3)16(17)21-14/h6-9H,4-5H2,1-3H3 |
| InChIKey | ZZKOUYQEQZNHJY-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.28 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |