C16H20N2O3S — CID 7997753
2-methyl-5-piperidin-1-ylsulfonyl-N-prop-2-ynylbenzamide (PubChem CID 7997753) has the molecular formula C16H20N2O3S and a molecular weight of 320.41 g/mol. Its IUPAC name is 2-methyl-5-piperidin-1-ylsulfonyl-N-prop-2-ynylbenzamide.
| Compound Name | 2-methyl-5-piperidin-1-ylsulfonyl-N-prop-2-ynylbenzamide |
|---|---|
| PubChem CID | 7997753 |
| Molecular Formula | C16H20N2O3S |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | 2-methyl-5-piperidin-1-ylsulfonyl-N-prop-2-ynylbenzamide |
| SMILES | C#CCNC(=O)c1cc(S(=O)(=O)N2CCCCC2)ccc1C |
| InChI | InChI=1S/C16H20N2O3S/c1-3-9-17-16(19)15-12-14(8-7-13(15)2)22(20,21)18-10-5-4-6-11-18/h1,7-8,12H,4-6,9-11H2,2H3,(H,17,19) |
| InChIKey | JLCGEGYXGBGKGV-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|