C13H14F3NO3S — CID 79977680
5-(3-hydroxyprop-1-ynyl)-4-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]thiophene-2-carboxamide (PubChem CID 79977680) has the molecular formula C13H14F3NO3S and a molecular weight of 321.32 g/mol. Its IUPAC name is 5-(3-hydroxyprop-1-ynyl)-4-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]thiophene-2-carboxamide.
| Compound Name | 5-(3-hydroxyprop-1-ynyl)-4-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 79977680 |
| Molecular Formula | C13H14F3NO3S |
| Molecular Weight | 321.32 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | 5-(3-hydroxyprop-1-ynyl)-4-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]thiophene-2-carboxamide |
| SMILES | Cc1cc(C(=O)NCCOCC(F)(F)F)sc1C#CCO |
| InChI | InChI=1S/C13H14F3NO3S/c1-9-7-11(21-10(9)3-2-5-18)12(19)17-4-6-20-8-13(14,15)16/h7,18H,4-6,8H2,1H3,(H,17,19) |
| InChIKey | HQZHYAZAAKJUQB-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.32 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|