C18H28N2 — CID 79978719
N-[(4-cyclopropylphenyl)methyl]-2-(4-methylpiperidin-1-yl)ethanamine (PubChem CID 79978719) has the molecular formula C18H28N2 and a molecular weight of 272.44 g/mol. Its IUPAC name is N-[(4-cyclopropylphenyl)methyl]-2-(4-methylpiperidin-1-yl)ethanamine.
| Compound Name | N-[(4-cyclopropylphenyl)methyl]-2-(4-methylpiperidin-1-yl)ethanamine |
|---|---|
| PubChem CID | 79978719 |
| Molecular Formula | C18H28N2 |
| Molecular Weight | 272.44 g/mol |
| Exact Mass | 272.23 |
| IUPAC Name | N-[(4-cyclopropylphenyl)methyl]-2-(4-methylpiperidin-1-yl)ethanamine |
| SMILES | CC1CCN(CCNCc2ccc(C3CC3)cc2)CC1 |
| InChI | InChI=1S/C18H28N2/c1-15-8-11-20(12-9-15)13-10-19-14-16-2-4-17(5-3-16)18-6-7-18/h2-5,15,18-19H,6-14H2,1H3 |
| InChIKey | DBYXUUHCVHKACM-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.44 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|