methyl 2-[(2-cyclopropylphenyl)methylamino]acetate

C13H17NO2 — CID 79978808

IUPACmethyl 2-[(2-cyclopropylphenyl)methylamino]acetate
SMILESCOC(=O)CNCc1ccccc1C1CC1
InChIInChI=1S/C13H17NO2/c1-16-13(15)9-14-8-11-4-2-3-5-12(11)10-6-7-10/h2-5,10,14H,6-9H2,1H3
InChIKeyJNEQIXNKODNLJE-UHFFFAOYSA-N
MW219.28 g/mol
LogP1.83
Rot. Bonds5

About methyl 2-[(2-cyclopropylphenyl)methylamino]acetate

methyl 2-[(2-cyclopropylphenyl)methylamino]acetate (PubChem CID 79978808) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is methyl 2-[(2-cyclopropylphenyl)methylamino]acetate.

Molecular Properties

Compound Namemethyl 2-[(2-cyclopropylphenyl)methylamino]acetate
PubChem CID79978808
Molecular FormulaC13H17NO2
Molecular Weight219.28 g/mol
Exact Mass219.13
IUPAC Namemethyl 2-[(2-cyclopropylphenyl)methylamino]acetate
SMILESCOC(=O)CNCc1ccccc1C1CC1
InChIInChI=1S/C13H17NO2/c1-16-13(15)9-14-8-11-4-2-3-5-12(11)10-6-7-10/h2-5,10,14H,6-9H2,1H3
InChIKeyJNEQIXNKODNLJE-UHFFFAOYSA-N
XLogP1.83
TPSA38.33 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500219.28
LogP ≤ 51.83
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze methyl 2-[(2-cyclopropylphenyl)methylamino]acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[(2-cyclopropylphenyl)methylamino]acetate?
The IUPAC name of methyl 2-[(2-cyclopropylphenyl)methylamino]acetate (CID 79978808) is methyl 2-[(2-cyclopropylphenyl)methylamino]acetate.
What is the SMILES notation for methyl 2-[(2-cyclopropylphenyl)methylamino]acetate?
The canonical SMILES for methyl 2-[(2-cyclopropylphenyl)methylamino]acetate is COC(=O)CNCc1ccccc1C1CC1.
What is the InChIKey of methyl 2-[(2-cyclopropylphenyl)methylamino]acetate?
The InChIKey is JNEQIXNKODNLJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO2/c1-16-13(15)9-14-8-11-4-2-3-5-12(11)10-6-7-10/h2-5,10,14H,6-9H2,1H3.
What are the key properties of methyl 2-[(2-cyclopropylphenyl)methylamino]acetate?
methyl 2-[(2-cyclopropylphenyl)methylamino]acetate has a molecular weight of 219.28 g/mol, XLogP of 1.83, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(2-cyclopropylphenyl)methylamino]acetate is sourced from PubChem (CID 79978808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).