C17H18ClN — CID 79979115
4-chloro-N-[(3-cyclopropylphenyl)methyl]-2-methylaniline (PubChem CID 79979115) has the molecular formula C17H18ClN and a molecular weight of 271.79 g/mol. Its IUPAC name is 4-chloro-N-[(3-cyclopropylphenyl)methyl]-2-methylaniline.
| Compound Name | 4-chloro-N-[(3-cyclopropylphenyl)methyl]-2-methylaniline |
|---|---|
| PubChem CID | 79979115 |
| Molecular Formula | C17H18ClN |
| Molecular Weight | 271.79 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | 4-chloro-N-[(3-cyclopropylphenyl)methyl]-2-methylaniline |
| SMILES | Cc1cc(Cl)ccc1NCc1cccc(C2CC2)c1 |
| InChI | InChI=1S/C17H18ClN/c1-12-9-16(18)7-8-17(12)19-11-13-3-2-4-15(10-13)14-5-6-14/h2-4,7-10,14,19H,5-6,11H2,1H3 |
| InChIKey | QNFHHXNGXJFQSQ-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.79 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |