C17H19NO — CID 79979621
N-[(4-cyclopropylphenyl)methyl]-4-methoxyaniline (PubChem CID 79979621) has the molecular formula C17H19NO and a molecular weight of 253.34 g/mol. Its IUPAC name is N-[(4-cyclopropylphenyl)methyl]-4-methoxyaniline.
| Compound Name | N-[(4-cyclopropylphenyl)methyl]-4-methoxyaniline |
|---|---|
| PubChem CID | 79979621 |
| Molecular Formula | C17H19NO |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | N-[(4-cyclopropylphenyl)methyl]-4-methoxyaniline |
| SMILES | COc1ccc(NCc2ccc(C3CC3)cc2)cc1 |
| InChI | InChI=1S/C17H19NO/c1-19-17-10-8-16(9-11-17)18-12-13-2-4-14(5-3-13)15-6-7-15/h2-5,8-11,15,18H,6-7,12H2,1H3 |
| InChIKey | LENOOPNVGBOQGE-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|