About 5-bromo-4,6-dichloro-2-(3-cyclopropylphenyl)pyrimidine
5-bromo-4,6-dichloro-2-(3-cyclopropylphenyl)pyrimidine (PubChem CID 79979983) has the molecular formula C13H9BrCl2N2
and a molecular weight of 344.04 g/mol. Its IUPAC name is 5-bromo-4,6-dichloro-2-(3-cyclopropylphenyl)pyrimidine.
Molecular Properties
| Compound Name | 5-bromo-4,6-dichloro-2-(3-cyclopropylphenyl)pyrimidine |
| PubChem CID | 79979983 |
| Molecular Formula | C13H9BrCl2N2 |
| Molecular Weight | 344.04 g/mol |
| Exact Mass | 341.93 |
| IUPAC Name | 5-bromo-4,6-dichloro-2-(3-cyclopropylphenyl)pyrimidine |
| SMILES | Clc1nc(-c2cccc(C3CC3)c2)nc(Cl)c1Br |
| InChI | InChI=1S/C13H9BrCl2N2/c14-10-11(15)17-13(18-12(10)16)9-3-1-2-8(6-9)7-4-5-7/h1-3,6-7H,4-5H2 |
| InChIKey | JOXPJPZPNIFIOX-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 344.04 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-bromo-4,6-dichloro-2-(3-cyclopropylphenyl)pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-4,6-dichloro-2-(3-cyclopropylphenyl)pyrimidine?
The IUPAC name of 5-bromo-4,6-dichloro-2-(3-cyclopropylphenyl)pyrimidine (CID 79979983) is 5-bromo-4,6-dichloro-2-(3-cyclopropylphenyl)pyrimidine.
What is the SMILES notation for 5-bromo-4,6-dichloro-2-(3-cyclopropylphenyl)pyrimidine?
The canonical SMILES for 5-bromo-4,6-dichloro-2-(3-cyclopropylphenyl)pyrimidine is Clc1nc(-c2cccc(C3CC3)c2)nc(Cl)c1Br.
What is the InChIKey of 5-bromo-4,6-dichloro-2-(3-cyclopropylphenyl)pyrimidine?
The InChIKey is JOXPJPZPNIFIOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9BrCl2N2/c14-10-11(15)17-13(18-12(10)16)9-3-1-2-8(6-9)7-4-5-7/h1-3,6-7H,4-5H2.
What are the key properties of 5-bromo-4,6-dichloro-2-(3-cyclopropylphenyl)pyrimidine?
5-bromo-4,6-dichloro-2-(3-cyclopropylphenyl)pyrimidine has a molecular weight of 344.04 g/mol, XLogP of 5.09, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-4,6-dichloro-2-(3-cyclopropylphenyl)pyrimidine is sourced from PubChem (CID 79979983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).