C24H26N2O5 — CID 7998033
[2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] (3R)-1-(furan-2-ylmethyl)-5-oxopyrrolidine-3-carboxylate (PubChem CID 7998033) has the molecular formula C24H26N2O5 and a molecular weight of 422.48 g/mol. Its IUPAC name is [2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] (3R)-1-(furan-2-ylmethyl)-5-oxopyrrolidine-3-carboxylate.
| Compound Name | [2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] (3R)-1-(furan-2-ylmethyl)-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 7998033 |
| Molecular Formula | C24H26N2O5 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | [2-oxo-3-(1,3,3-trimethylindol-2-ylidene)propyl] (3R)-1-(furan-2-ylmethyl)-5-oxopyrrolidine-3-carboxylate |
| SMILES | CN1C(=CC(=O)COC(=O)[C@@H]2CC(=O)N(Cc3ccco3)C2)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C24H26N2O5/c1-24(2)19-8-4-5-9-20(19)25(3)21(24)12-17(27)15-31-23(29)16-11-22(28)26(13-16)14-18-7-6-10-30-18/h4-10,12,16H,11,13-15H2,1-3H3/t16-/m1/s1 |
| InChIKey | QWGQVAILEKVRQH-MRXNPFEDSA-N |
| XLogP | 3.05 |
| TPSA | 80.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|