About 2-tert-butyl-4-(3-cyclopropylphenyl)imidazole-1,5-diamine
2-tert-butyl-4-(3-cyclopropylphenyl)imidazole-1,5-diamine (PubChem CID 79980757) has the molecular formula C16H22N4
and a molecular weight of 270.38 g/mol. Its IUPAC name is 2-tert-butyl-4-(3-cyclopropylphenyl)imidazole-1,5-diamine.
Molecular Properties
| Compound Name | 2-tert-butyl-4-(3-cyclopropylphenyl)imidazole-1,5-diamine |
| PubChem CID | 79980757 |
| Molecular Formula | C16H22N4 |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | 2-tert-butyl-4-(3-cyclopropylphenyl)imidazole-1,5-diamine |
| SMILES | CC(C)(C)c1nc(-c2cccc(C3CC3)c2)c(N)n1N |
| InChI | InChI=1S/C16H22N4/c1-16(2,3)15-19-13(14(17)20(15)18)12-6-4-5-11(9-12)10-7-8-10/h4-6,9-10H,7-8,17-18H2,1-3H3 |
| InChIKey | CFKXNKVNSONSTF-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 69.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-tert-butyl-4-(3-cyclopropylphenyl)imidazole-1,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-4-(3-cyclopropylphenyl)imidazole-1,5-diamine?
The IUPAC name of 2-tert-butyl-4-(3-cyclopropylphenyl)imidazole-1,5-diamine (CID 79980757) is 2-tert-butyl-4-(3-cyclopropylphenyl)imidazole-1,5-diamine.
What is the SMILES notation for 2-tert-butyl-4-(3-cyclopropylphenyl)imidazole-1,5-diamine?
The canonical SMILES for 2-tert-butyl-4-(3-cyclopropylphenyl)imidazole-1,5-diamine is CC(C)(C)c1nc(-c2cccc(C3CC3)c2)c(N)n1N.
What is the InChIKey of 2-tert-butyl-4-(3-cyclopropylphenyl)imidazole-1,5-diamine?
The InChIKey is CFKXNKVNSONSTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22N4/c1-16(2,3)15-19-13(14(17)20(15)18)12-6-4-5-11(9-12)10-7-8-10/h4-6,9-10H,7-8,17-18H2,1-3H3.
What are the key properties of 2-tert-butyl-4-(3-cyclopropylphenyl)imidazole-1,5-diamine?
2-tert-butyl-4-(3-cyclopropylphenyl)imidazole-1,5-diamine has a molecular weight of 270.38 g/mol, XLogP of 3.02, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-4-(3-cyclopropylphenyl)imidazole-1,5-diamine is sourced from PubChem (CID 79980757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).