About N-[3-(3,4-dihydro-2H-pyrrol-5-ylsulfamoyl)phenyl]-1-methyl-6-oxopyridazine-3-carboxamide
N-[3-(3,4-dihydro-2H-pyrrol-5-ylsulfamoyl)phenyl]-1-methyl-6-oxopyridazine-3-carboxamide (PubChem CID 7998142) has the molecular formula C16H17N5O4S
and a molecular weight of 375.41 g/mol. Its IUPAC name is N-[3-(3,4-dihydro-2H-pyrrol-5-ylsulfamoyl)phenyl]-1-methyl-6-oxopyridazine-3-carboxamide.
Molecular Properties
| Compound Name | N-[3-(3,4-dihydro-2H-pyrrol-5-ylsulfamoyl)phenyl]-1-methyl-6-oxopyridazine-3-carboxamide |
| PubChem CID | 7998142 |
| Molecular Formula | C16H17N5O4S |
| Molecular Weight | 375.41 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | N-[3-(3,4-dihydro-2H-pyrrol-5-ylsulfamoyl)phenyl]-1-methyl-6-oxopyridazine-3-carboxamide |
| SMILES | Cn1nc(C(=O)Nc2cccc(S(=O)(=O)NC3=NCCC3)c2)ccc1=O |
| InChI | InChI=1S/C16H17N5O4S/c1-21-15(22)8-7-13(19-21)16(23)18-11-4-2-5-12(10-11)26(24,25)20-14-6-3-9-17-14/h2,4-5,7-8,10H,3,6,9H2,1H3,(H,17,20)(H,18,23) |
| InChIKey | ALHGSFRRCAGSJE-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.41 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N-[3-(3,4-dihydro-2H-pyrrol-5-ylsulfamoyl)phenyl]-1-methyl-6-oxopyridazine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(3,4-dihydro-2H-pyrrol-5-ylsulfamoyl)phenyl]-1-methyl-6-oxopyridazine-3-carboxamide?
The IUPAC name of N-[3-(3,4-dihydro-2H-pyrrol-5-ylsulfamoyl)phenyl]-1-methyl-6-oxopyridazine-3-carboxamide (CID 7998142) is N-[3-(3,4-dihydro-2H-pyrrol-5-ylsulfamoyl)phenyl]-1-methyl-6-oxopyridazine-3-carboxamide.
What is the SMILES notation for N-[3-(3,4-dihydro-2H-pyrrol-5-ylsulfamoyl)phenyl]-1-methyl-6-oxopyridazine-3-carboxamide?
The canonical SMILES for N-[3-(3,4-dihydro-2H-pyrrol-5-ylsulfamoyl)phenyl]-1-methyl-6-oxopyridazine-3-carboxamide is Cn1nc(C(=O)Nc2cccc(S(=O)(=O)NC3=NCCC3)c2)ccc1=O.
What is the InChIKey of N-[3-(3,4-dihydro-2H-pyrrol-5-ylsulfamoyl)phenyl]-1-methyl-6-oxopyridazine-3-carboxamide?
The InChIKey is ALHGSFRRCAGSJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17N5O4S/c1-21-15(22)8-7-13(19-21)16(23)18-11-4-2-5-12(10-11)26(24,25)20-14-6-3-9-17-14/h2,4-5,7-8,10H,3,6,9H2,1H3,(H,17,20)(H,18,23).
What are the key properties of N-[3-(3,4-dihydro-2H-pyrrol-5-ylsulfamoyl)phenyl]-1-methyl-6-oxopyridazine-3-carboxamide?
N-[3-(3,4-dihydro-2H-pyrrol-5-ylsulfamoyl)phenyl]-1-methyl-6-oxopyridazine-3-carboxamide has a molecular weight of 375.41 g/mol, XLogP of 0.50, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(3,4-dihydro-2H-pyrrol-5-ylsulfamoyl)phenyl]-1-methyl-6-oxopyridazine-3-carboxamide is sourced from PubChem (CID 7998142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).