About 6-fluoro-2,3-dihydro-1-benzofuran-3-ol
6-fluoro-2,3-dihydro-1-benzofuran-3-ol (PubChem CID 79982529) has the molecular formula C8H7FO2
and a molecular weight of 154.14 g/mol. Its IUPAC name is 6-fluoro-2,3-dihydro-1-benzofuran-3-ol.
Molecular Properties
| Compound Name | 6-fluoro-2,3-dihydro-1-benzofuran-3-ol |
| PubChem CID | 79982529 |
| Molecular Formula | C8H7FO2 |
| Molecular Weight | 154.14 g/mol |
| Exact Mass | 154.04 |
| IUPAC Name | 6-fluoro-2,3-dihydro-1-benzofuran-3-ol |
| SMILES | OC1COc2cc(F)ccc21 |
| InChI | InChI=1S/C8H7FO2/c9-5-1-2-6-7(10)4-11-8(6)3-5/h1-3,7,10H,4H2 |
| InChIKey | FATZIYNRYWWXOF-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.14 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-fluoro-2,3-dihydro-1-benzofuran-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-2,3-dihydro-1-benzofuran-3-ol?
The IUPAC name of 6-fluoro-2,3-dihydro-1-benzofuran-3-ol (CID 79982529) is 6-fluoro-2,3-dihydro-1-benzofuran-3-ol.
What is the SMILES notation for 6-fluoro-2,3-dihydro-1-benzofuran-3-ol?
The canonical SMILES for 6-fluoro-2,3-dihydro-1-benzofuran-3-ol is OC1COc2cc(F)ccc21.
What is the InChIKey of 6-fluoro-2,3-dihydro-1-benzofuran-3-ol?
The InChIKey is FATZIYNRYWWXOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7FO2/c9-5-1-2-6-7(10)4-11-8(6)3-5/h1-3,7,10H,4H2.
What are the key properties of 6-fluoro-2,3-dihydro-1-benzofuran-3-ol?
6-fluoro-2,3-dihydro-1-benzofuran-3-ol has a molecular weight of 154.14 g/mol, XLogP of 1.25, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-2,3-dihydro-1-benzofuran-3-ol is sourced from PubChem (CID 79982529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).