C18H28N2 — CID 79983628
N-[(2-cyclopropylphenyl)methyl]-N-propylpiperidin-3-amine (PubChem CID 79983628) has the molecular formula C18H28N2 and a molecular weight of 272.44 g/mol. Its IUPAC name is N-[(2-cyclopropylphenyl)methyl]-N-propylpiperidin-3-amine.
| Compound Name | N-[(2-cyclopropylphenyl)methyl]-N-propylpiperidin-3-amine |
|---|---|
| PubChem CID | 79983628 |
| Molecular Formula | C18H28N2 |
| Molecular Weight | 272.44 g/mol |
| Exact Mass | 272.23 |
| IUPAC Name | N-[(2-cyclopropylphenyl)methyl]-N-propylpiperidin-3-amine |
| SMILES | CCCN(Cc1ccccc1C1CC1)C1CCCNC1 |
| InChI | InChI=1S/C18H28N2/c1-2-12-20(17-7-5-11-19-13-17)14-16-6-3-4-8-18(16)15-9-10-15/h3-4,6,8,15,17,19H,2,5,7,9-14H2,1H3 |
| InChIKey | YGMOEFMJGOMMCW-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.44 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |