C18H15NO3S2 — CID 7998369
2-oxopropyl 2-(2-phenyl-4-thiophen-2-yl-1,3-thiazol-5-yl)acetate (PubChem CID 7998369) has the molecular formula C18H15NO3S2 and a molecular weight of 357.46 g/mol. Its IUPAC name is 2-oxopropyl 2-(2-phenyl-4-thiophen-2-yl-1,3-thiazol-5-yl)acetate.
| Compound Name | 2-oxopropyl 2-(2-phenyl-4-thiophen-2-yl-1,3-thiazol-5-yl)acetate |
|---|---|
| PubChem CID | 7998369 |
| Molecular Formula | C18H15NO3S2 |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.05 |
| IUPAC Name | 2-oxopropyl 2-(2-phenyl-4-thiophen-2-yl-1,3-thiazol-5-yl)acetate |
| SMILES | CC(=O)COC(=O)Cc1sc(-c2ccccc2)nc1-c1cccs1 |
| InChI | InChI=1S/C18H15NO3S2/c1-12(20)11-22-16(21)10-15-17(14-8-5-9-23-14)19-18(24-15)13-6-3-2-4-7-13/h2-9H,10-11H2,1H3 |
| InChIKey | WFGWBDRWVVBYQL-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |