C18H18N2 — CID 79984649
2-(3-cyclopropylphenyl)-2-(2-methylanilino)acetonitrile (PubChem CID 79984649) has the molecular formula C18H18N2 and a molecular weight of 262.36 g/mol. Its IUPAC name is 2-(3-cyclopropylphenyl)-2-(2-methylanilino)acetonitrile.
| Compound Name | 2-(3-cyclopropylphenyl)-2-(2-methylanilino)acetonitrile |
|---|---|
| PubChem CID | 79984649 |
| Molecular Formula | C18H18N2 |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | 2-(3-cyclopropylphenyl)-2-(2-methylanilino)acetonitrile |
| SMILES | Cc1ccccc1NC(C#N)c1cccc(C2CC2)c1 |
| InChI | InChI=1S/C18H18N2/c1-13-5-2-3-8-17(13)20-18(12-19)16-7-4-6-15(11-16)14-9-10-14/h2-8,11,14,18,20H,9-10H2,1H3 |
| InChIKey | CJXBUVUMFQCILK-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |