C15H24N4 — CID 79986335
[3-(3,5-dimethyl-1-adamantyl)-1H-1,2,4-triazol-5-yl]methanamine (PubChem CID 79986335) has the molecular formula C15H24N4 and a molecular weight of 260.38 g/mol. Its IUPAC name is [3-(3,5-dimethyl-1-adamantyl)-1H-1,2,4-triazol-5-yl]methanamine.
| Compound Name | [3-(3,5-dimethyl-1-adamantyl)-1H-1,2,4-triazol-5-yl]methanamine |
|---|---|
| PubChem CID | 79986335 |
| Molecular Formula | C15H24N4 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.20 |
| IUPAC Name | [3-(3,5-dimethyl-1-adamantyl)-1H-1,2,4-triazol-5-yl]methanamine |
| SMILES | CC12CC3CC(C)(C1)CC(c1n[nH]c(CN)n1)(C3)C2 |
| InChI | InChI=1S/C15H24N4/c1-13-3-10-4-14(2,7-13)9-15(5-10,8-13)12-17-11(6-16)18-19-12/h10H,3-9,16H2,1-2H3,(H,17,18,19) |
| InChIKey | PXOIURFTYAALGF-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |