About 5-(chloromethyl)-2-(3,5-dimethyl-1-adamantyl)-1H-imidazole
5-(chloromethyl)-2-(3,5-dimethyl-1-adamantyl)-1H-imidazole (PubChem CID 79986564) has the molecular formula C16H23ClN2
and a molecular weight of 278.83 g/mol. Its IUPAC name is 5-(chloromethyl)-2-(3,5-dimethyl-1-adamantyl)-1H-imidazole.
Molecular Properties
| Compound Name | 5-(chloromethyl)-2-(3,5-dimethyl-1-adamantyl)-1H-imidazole |
| PubChem CID | 79986564 |
| Molecular Formula | C16H23ClN2 |
| Molecular Weight | 278.83 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | 5-(chloromethyl)-2-(3,5-dimethyl-1-adamantyl)-1H-imidazole |
| SMILES | CC12CC3CC(C)(C1)CC(c1ncc(CCl)[nH]1)(C3)C2 |
| InChI | InChI=1S/C16H23ClN2/c1-14-3-11-4-15(2,8-14)10-16(5-11,9-14)13-18-7-12(6-17)19-13/h7,11H,3-6,8-10H2,1-2H3,(H,18,19) |
| InChIKey | GHUOBPVKXLYGRK-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.83 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-(chloromethyl)-2-(3,5-dimethyl-1-adamantyl)-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(chloromethyl)-2-(3,5-dimethyl-1-adamantyl)-1H-imidazole?
The IUPAC name of 5-(chloromethyl)-2-(3,5-dimethyl-1-adamantyl)-1H-imidazole (CID 79986564) is 5-(chloromethyl)-2-(3,5-dimethyl-1-adamantyl)-1H-imidazole.
What is the SMILES notation for 5-(chloromethyl)-2-(3,5-dimethyl-1-adamantyl)-1H-imidazole?
The canonical SMILES for 5-(chloromethyl)-2-(3,5-dimethyl-1-adamantyl)-1H-imidazole is CC12CC3CC(C)(C1)CC(c1ncc(CCl)[nH]1)(C3)C2.
What is the InChIKey of 5-(chloromethyl)-2-(3,5-dimethyl-1-adamantyl)-1H-imidazole?
The InChIKey is GHUOBPVKXLYGRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23ClN2/c1-14-3-11-4-15(2,8-14)10-16(5-11,9-14)13-18-7-12(6-17)19-13/h7,11H,3-6,8-10H2,1-2H3,(H,18,19).
What are the key properties of 5-(chloromethyl)-2-(3,5-dimethyl-1-adamantyl)-1H-imidazole?
5-(chloromethyl)-2-(3,5-dimethyl-1-adamantyl)-1H-imidazole has a molecular weight of 278.83 g/mol, XLogP of 4.40, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(chloromethyl)-2-(3,5-dimethyl-1-adamantyl)-1H-imidazole is sourced from PubChem (CID 79986564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).