About 1-(3,5-dimethyl-1-adamantyl)-2-propoxyethanamine
1-(3,5-dimethyl-1-adamantyl)-2-propoxyethanamine (PubChem CID 79987019) has the molecular formula C17H31NO
and a molecular weight of 265.44 g/mol. Its IUPAC name is 1-(3,5-dimethyl-1-adamantyl)-2-propoxyethanamine.
Molecular Properties
| Compound Name | 1-(3,5-dimethyl-1-adamantyl)-2-propoxyethanamine |
| PubChem CID | 79987019 |
| Molecular Formula | C17H31NO |
| Molecular Weight | 265.44 g/mol |
| Exact Mass | 265.24 |
| IUPAC Name | 1-(3,5-dimethyl-1-adamantyl)-2-propoxyethanamine |
| SMILES | CCCOCC(N)C12CC3CC(C)(CC(C)(C3)C1)C2 |
| InChI | InChI=1S/C17H31NO/c1-4-5-19-9-14(18)17-8-13-6-15(2,11-17)10-16(3,7-13)12-17/h13-14H,4-12,18H2,1-3H3 |
| InChIKey | PWNXOKZCMYXYML-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.44 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-(3,5-dimethyl-1-adamantyl)-2-propoxyethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,5-dimethyl-1-adamantyl)-2-propoxyethanamine?
The IUPAC name of 1-(3,5-dimethyl-1-adamantyl)-2-propoxyethanamine (CID 79987019) is 1-(3,5-dimethyl-1-adamantyl)-2-propoxyethanamine.
What is the SMILES notation for 1-(3,5-dimethyl-1-adamantyl)-2-propoxyethanamine?
The canonical SMILES for 1-(3,5-dimethyl-1-adamantyl)-2-propoxyethanamine is CCCOCC(N)C12CC3CC(C)(CC(C)(C3)C1)C2.
What is the InChIKey of 1-(3,5-dimethyl-1-adamantyl)-2-propoxyethanamine?
The InChIKey is PWNXOKZCMYXYML-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H31NO/c1-4-5-19-9-14(18)17-8-13-6-15(2,11-17)10-16(3,7-13)12-17/h13-14H,4-12,18H2,1-3H3.
What are the key properties of 1-(3,5-dimethyl-1-adamantyl)-2-propoxyethanamine?
1-(3,5-dimethyl-1-adamantyl)-2-propoxyethanamine has a molecular weight of 265.44 g/mol, XLogP of 3.74, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,5-dimethyl-1-adamantyl)-2-propoxyethanamine is sourced from PubChem (CID 79987019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).