C17H29N — CID 79987172
1-(3,5-dimethyl-1-adamantyl)-N,2-dimethylprop-2-en-1-amine (PubChem CID 79987172) has the molecular formula C17H29N and a molecular weight of 247.43 g/mol. Its IUPAC name is 1-(3,5-dimethyl-1-adamantyl)-N,2-dimethylprop-2-en-1-amine.
| Compound Name | 1-(3,5-dimethyl-1-adamantyl)-N,2-dimethylprop-2-en-1-amine |
|---|---|
| PubChem CID | 79987172 |
| Molecular Formula | C17H29N |
| Molecular Weight | 247.43 g/mol |
| Exact Mass | 247.23 |
| IUPAC Name | 1-(3,5-dimethyl-1-adamantyl)-N,2-dimethylprop-2-en-1-amine |
| SMILES | C=C(C)C(NC)C12CC3CC(C)(CC(C)(C3)C1)C2 |
| InChI | InChI=1S/C17H29N/c1-12(2)14(18-5)17-8-13-6-15(3,10-17)9-16(4,7-13)11-17/h13-14,18H,1,6-11H2,2-5H3 |
| InChIKey | LSCURUPXPRSIQA-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.43 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|