C20H29N — CID 79987752
2-(3,5-dimethyl-1-adamantyl)-1-phenylethanamine (PubChem CID 79987752) has the molecular formula C20H29N and a molecular weight of 283.46 g/mol. Its IUPAC name is 2-(3,5-dimethyl-1-adamantyl)-1-phenylethanamine.
| Compound Name | 2-(3,5-dimethyl-1-adamantyl)-1-phenylethanamine |
|---|---|
| PubChem CID | 79987752 |
| Molecular Formula | C20H29N |
| Molecular Weight | 283.46 g/mol |
| Exact Mass | 283.23 |
| IUPAC Name | 2-(3,5-dimethyl-1-adamantyl)-1-phenylethanamine |
| SMILES | CC12CC3CC(C)(C1)CC(CC(N)c1ccccc1)(C3)C2 |
| InChI | InChI=1S/C20H29N/c1-18-8-15-9-19(2,12-18)14-20(10-15,13-18)11-17(21)16-6-4-3-5-7-16/h3-7,15,17H,8-14,21H2,1-2H3 |
| InChIKey | NNMIATPIGAAASV-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.46 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |