About 2-(4-ethoxyphenyl)-4-(piperidin-1-ylmethyl)-1,3-thiazole
2-(4-ethoxyphenyl)-4-(piperidin-1-ylmethyl)-1,3-thiazole (PubChem CID 7998816) has the molecular formula C17H22N2OS
and a molecular weight of 302.44 g/mol. Its IUPAC name is 2-(4-ethoxyphenyl)-4-(piperidin-1-ylmethyl)-1,3-thiazole.
Molecular Properties
| Compound Name | 2-(4-ethoxyphenyl)-4-(piperidin-1-ylmethyl)-1,3-thiazole |
| PubChem CID | 7998816 |
| Molecular Formula | C17H22N2OS |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 2-(4-ethoxyphenyl)-4-(piperidin-1-ylmethyl)-1,3-thiazole |
| SMILES | CCOc1ccc(-c2nc(CN3CCCCC3)cs2)cc1 |
| InChI | InChI=1S/C17H22N2OS/c1-2-20-16-8-6-14(7-9-16)17-18-15(13-21-17)12-19-10-4-3-5-11-19/h6-9,13H,2-5,10-12H2,1H3 |
| InChIKey | PWXNRUYPZHYKAO-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(4-ethoxyphenyl)-4-(piperidin-1-ylmethyl)-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-ethoxyphenyl)-4-(piperidin-1-ylmethyl)-1,3-thiazole?
The IUPAC name of 2-(4-ethoxyphenyl)-4-(piperidin-1-ylmethyl)-1,3-thiazole (CID 7998816) is 2-(4-ethoxyphenyl)-4-(piperidin-1-ylmethyl)-1,3-thiazole.
What is the SMILES notation for 2-(4-ethoxyphenyl)-4-(piperidin-1-ylmethyl)-1,3-thiazole?
The canonical SMILES for 2-(4-ethoxyphenyl)-4-(piperidin-1-ylmethyl)-1,3-thiazole is CCOc1ccc(-c2nc(CN3CCCCC3)cs2)cc1.
What is the InChIKey of 2-(4-ethoxyphenyl)-4-(piperidin-1-ylmethyl)-1,3-thiazole?
The InChIKey is PWXNRUYPZHYKAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22N2OS/c1-2-20-16-8-6-14(7-9-16)17-18-15(13-21-17)12-19-10-4-3-5-11-19/h6-9,13H,2-5,10-12H2,1H3.
What are the key properties of 2-(4-ethoxyphenyl)-4-(piperidin-1-ylmethyl)-1,3-thiazole?
2-(4-ethoxyphenyl)-4-(piperidin-1-ylmethyl)-1,3-thiazole has a molecular weight of 302.44 g/mol, XLogP of 4.19, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-ethoxyphenyl)-4-(piperidin-1-ylmethyl)-1,3-thiazole is sourced from PubChem (CID 7998816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).