About N-(3-aminobutyl)-2-(3,5-dimethyl-1-adamantyl)acetamide
N-(3-aminobutyl)-2-(3,5-dimethyl-1-adamantyl)acetamide (PubChem CID 79988209) has the molecular formula C18H32N2O
and a molecular weight of 292.47 g/mol. Its IUPAC name is N-(3-aminobutyl)-2-(3,5-dimethyl-1-adamantyl)acetamide.
Molecular Properties
| Compound Name | N-(3-aminobutyl)-2-(3,5-dimethyl-1-adamantyl)acetamide |
| PubChem CID | 79988209 |
| Molecular Formula | C18H32N2O |
| Molecular Weight | 292.47 g/mol |
| Exact Mass | 292.25 |
| IUPAC Name | N-(3-aminobutyl)-2-(3,5-dimethyl-1-adamantyl)acetamide |
| SMILES | CC(N)CCNC(=O)CC12CC3CC(C)(CC(C)(C3)C1)C2 |
| InChI | InChI=1S/C18H32N2O/c1-13(19)4-5-20-15(21)9-18-8-14-6-16(2,11-18)10-17(3,7-14)12-18/h13-14H,4-12,19H2,1-3H3,(H,20,21) |
| InChIKey | GJZWQKQZWRVFOH-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.47 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(3-aminobutyl)-2-(3,5-dimethyl-1-adamantyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-aminobutyl)-2-(3,5-dimethyl-1-adamantyl)acetamide?
The IUPAC name of N-(3-aminobutyl)-2-(3,5-dimethyl-1-adamantyl)acetamide (CID 79988209) is N-(3-aminobutyl)-2-(3,5-dimethyl-1-adamantyl)acetamide.
What is the SMILES notation for N-(3-aminobutyl)-2-(3,5-dimethyl-1-adamantyl)acetamide?
The canonical SMILES for N-(3-aminobutyl)-2-(3,5-dimethyl-1-adamantyl)acetamide is CC(N)CCNC(=O)CC12CC3CC(C)(CC(C)(C3)C1)C2.
What is the InChIKey of N-(3-aminobutyl)-2-(3,5-dimethyl-1-adamantyl)acetamide?
The InChIKey is GJZWQKQZWRVFOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H32N2O/c1-13(19)4-5-20-15(21)9-18-8-14-6-16(2,11-18)10-17(3,7-14)12-18/h13-14H,4-12,19H2,1-3H3,(H,20,21).
What are the key properties of N-(3-aminobutyl)-2-(3,5-dimethyl-1-adamantyl)acetamide?
N-(3-aminobutyl)-2-(3,5-dimethyl-1-adamantyl)acetamide has a molecular weight of 292.47 g/mol, XLogP of 3.23, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-aminobutyl)-2-(3,5-dimethyl-1-adamantyl)acetamide is sourced from PubChem (CID 79988209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).