About 2-(2-cyanophenoxy)-N-(1,3,5-trimethylpyrazol-4-yl)acetamide
2-(2-cyanophenoxy)-N-(1,3,5-trimethylpyrazol-4-yl)acetamide (PubChem CID 7998841) has the molecular formula C15H16N4O2
and a molecular weight of 284.32 g/mol. Its IUPAC name is 2-(2-cyanophenoxy)-N-(1,3,5-trimethylpyrazol-4-yl)acetamide.
Molecular Properties
| Compound Name | 2-(2-cyanophenoxy)-N-(1,3,5-trimethylpyrazol-4-yl)acetamide |
| PubChem CID | 7998841 |
| Molecular Formula | C15H16N4O2 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 2-(2-cyanophenoxy)-N-(1,3,5-trimethylpyrazol-4-yl)acetamide |
| SMILES | Cc1nn(C)c(C)c1NC(=O)COc1ccccc1C#N |
| InChI | InChI=1S/C15H16N4O2/c1-10-15(11(2)19(3)18-10)17-14(20)9-21-13-7-5-4-6-12(13)8-16/h4-7H,9H2,1-3H3,(H,17,20) |
| InChIKey | BPSNBHVGGMRWRL-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 79.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(2-cyanophenoxy)-N-(1,3,5-trimethylpyrazol-4-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-cyanophenoxy)-N-(1,3,5-trimethylpyrazol-4-yl)acetamide?
The IUPAC name of 2-(2-cyanophenoxy)-N-(1,3,5-trimethylpyrazol-4-yl)acetamide (CID 7998841) is 2-(2-cyanophenoxy)-N-(1,3,5-trimethylpyrazol-4-yl)acetamide.
What is the SMILES notation for 2-(2-cyanophenoxy)-N-(1,3,5-trimethylpyrazol-4-yl)acetamide?
The canonical SMILES for 2-(2-cyanophenoxy)-N-(1,3,5-trimethylpyrazol-4-yl)acetamide is Cc1nn(C)c(C)c1NC(=O)COc1ccccc1C#N.
What is the InChIKey of 2-(2-cyanophenoxy)-N-(1,3,5-trimethylpyrazol-4-yl)acetamide?
The InChIKey is BPSNBHVGGMRWRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16N4O2/c1-10-15(11(2)19(3)18-10)17-14(20)9-21-13-7-5-4-6-12(13)8-16/h4-7H,9H2,1-3H3,(H,17,20).
What are the key properties of 2-(2-cyanophenoxy)-N-(1,3,5-trimethylpyrazol-4-yl)acetamide?
2-(2-cyanophenoxy)-N-(1,3,5-trimethylpyrazol-4-yl)acetamide has a molecular weight of 284.32 g/mol, XLogP of 1.93, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-cyanophenoxy)-N-(1,3,5-trimethylpyrazol-4-yl)acetamide is sourced from PubChem (CID 7998841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).