About 3-amino-N-(3,5-dimethyl-1-adamantyl)-3-hydroxyimino-2-methylpropanamide
3-amino-N-(3,5-dimethyl-1-adamantyl)-3-hydroxyimino-2-methylpropanamide (PubChem CID 79988898) has the molecular formula C16H27N3O2
and a molecular weight of 293.41 g/mol. Its IUPAC name is 3-amino-N-(3,5-dimethyl-1-adamantyl)-3-hydroxyimino-2-methylpropanamide.
Molecular Properties
| Compound Name | 3-amino-N-(3,5-dimethyl-1-adamantyl)-3-hydroxyimino-2-methylpropanamide |
| PubChem CID | 79988898 |
| Molecular Formula | C16H27N3O2 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.21 |
| IUPAC Name | 3-amino-N-(3,5-dimethyl-1-adamantyl)-3-hydroxyimino-2-methylpropanamide |
| SMILES | CC(C(=O)NC12CC3CC(C)(CC(C)(C3)C1)C2)C(N)=NO |
| InChI | InChI=1S/C16H27N3O2/c1-10(12(17)19-21)13(20)18-16-6-11-4-14(2,8-16)7-15(3,5-11)9-16/h10-11,21H,4-9H2,1-3H3,(H2,17,19)(H,18,20) |
| InChIKey | CGMAIZTZSDPHKM-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-N-(3,5-dimethyl-1-adamantyl)-3-hydroxyimino-2-methylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-N-(3,5-dimethyl-1-adamantyl)-3-hydroxyimino-2-methylpropanamide?
The IUPAC name of 3-amino-N-(3,5-dimethyl-1-adamantyl)-3-hydroxyimino-2-methylpropanamide (CID 79988898) is 3-amino-N-(3,5-dimethyl-1-adamantyl)-3-hydroxyimino-2-methylpropanamide.
What is the SMILES notation for 3-amino-N-(3,5-dimethyl-1-adamantyl)-3-hydroxyimino-2-methylpropanamide?
The canonical SMILES for 3-amino-N-(3,5-dimethyl-1-adamantyl)-3-hydroxyimino-2-methylpropanamide is CC(C(=O)NC12CC3CC(C)(CC(C)(C3)C1)C2)C(N)=NO.
What is the InChIKey of 3-amino-N-(3,5-dimethyl-1-adamantyl)-3-hydroxyimino-2-methylpropanamide?
The InChIKey is CGMAIZTZSDPHKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H27N3O2/c1-10(12(17)19-21)13(20)18-16-6-11-4-14(2,8-16)7-15(3,5-11)9-16/h10-11,21H,4-9H2,1-3H3,(H2,17,19)(H,18,20).
What are the key properties of 3-amino-N-(3,5-dimethyl-1-adamantyl)-3-hydroxyimino-2-methylpropanamide?
3-amino-N-(3,5-dimethyl-1-adamantyl)-3-hydroxyimino-2-methylpropanamide has a molecular weight of 293.41 g/mol, XLogP of 2.23, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-N-(3,5-dimethyl-1-adamantyl)-3-hydroxyimino-2-methylpropanamide is sourced from PubChem (CID 79988898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).