About N-[4,5-bis(furan-2-yl)-1,3-thiazol-2-yl]furan-2-carboxamide
N-[4,5-bis(furan-2-yl)-1,3-thiazol-2-yl]furan-2-carboxamide (PubChem CID 7998972) has the molecular formula C16H10N2O4S
and a molecular weight of 326.33 g/mol. Its IUPAC name is N-[4,5-bis(furan-2-yl)-1,3-thiazol-2-yl]furan-2-carboxamide.
Molecular Properties
| Compound Name | N-[4,5-bis(furan-2-yl)-1,3-thiazol-2-yl]furan-2-carboxamide |
| PubChem CID | 7998972 |
| Molecular Formula | C16H10N2O4S |
| Molecular Weight | 326.33 g/mol |
| Exact Mass | 326.04 |
| IUPAC Name | N-[4,5-bis(furan-2-yl)-1,3-thiazol-2-yl]furan-2-carboxamide |
| SMILES | O=C(Nc1nc(-c2ccco2)c(-c2ccco2)s1)c1ccco1 |
| InChI | InChI=1S/C16H10N2O4S/c19-15(12-6-3-9-22-12)18-16-17-13(10-4-1-7-20-10)14(23-16)11-5-2-8-21-11/h1-9H,(H,17,18,19) |
| InChIKey | NOVCIKZNFNRXJB-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 81.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.33 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[4,5-bis(furan-2-yl)-1,3-thiazol-2-yl]furan-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4,5-bis(furan-2-yl)-1,3-thiazol-2-yl]furan-2-carboxamide?
The IUPAC name of N-[4,5-bis(furan-2-yl)-1,3-thiazol-2-yl]furan-2-carboxamide (CID 7998972) is N-[4,5-bis(furan-2-yl)-1,3-thiazol-2-yl]furan-2-carboxamide.
What is the SMILES notation for N-[4,5-bis(furan-2-yl)-1,3-thiazol-2-yl]furan-2-carboxamide?
The canonical SMILES for N-[4,5-bis(furan-2-yl)-1,3-thiazol-2-yl]furan-2-carboxamide is O=C(Nc1nc(-c2ccco2)c(-c2ccco2)s1)c1ccco1.
What is the InChIKey of N-[4,5-bis(furan-2-yl)-1,3-thiazol-2-yl]furan-2-carboxamide?
The InChIKey is NOVCIKZNFNRXJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10N2O4S/c19-15(12-6-3-9-22-12)18-16-17-13(10-4-1-7-20-10)14(23-16)11-5-2-8-21-11/h1-9H,(H,17,18,19).
What are the key properties of N-[4,5-bis(furan-2-yl)-1,3-thiazol-2-yl]furan-2-carboxamide?
N-[4,5-bis(furan-2-yl)-1,3-thiazol-2-yl]furan-2-carboxamide has a molecular weight of 326.33 g/mol, XLogP of 4.51, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4,5-bis(furan-2-yl)-1,3-thiazol-2-yl]furan-2-carboxamide is sourced from PubChem (CID 7998972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).