C17H24FN3 — CID 79990698
2-(3,5-dimethyl-1-adamantyl)-5-fluoro-6-methylpyrimidin-4-amine (PubChem CID 79990698) has the molecular formula C17H24FN3 and a molecular weight of 289.40 g/mol. Its IUPAC name is 2-(3,5-dimethyl-1-adamantyl)-5-fluoro-6-methylpyrimidin-4-amine.
| Compound Name | 2-(3,5-dimethyl-1-adamantyl)-5-fluoro-6-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 79990698 |
| Molecular Formula | C17H24FN3 |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | 2-(3,5-dimethyl-1-adamantyl)-5-fluoro-6-methylpyrimidin-4-amine |
| SMILES | Cc1nc(C23CC4CC(C)(CC(C)(C4)C2)C3)nc(N)c1F |
| InChI | InChI=1S/C17H24FN3/c1-10-12(18)13(19)21-14(20-10)17-6-11-4-15(2,8-17)7-16(3,5-11)9-17/h11H,4-9H2,1-3H3,(H2,19,20,21) |
| InChIKey | SFEFEYPLBNLNPQ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |