About N-[2-[[2-(3,4-dichloroanilino)-2-oxoethyl]-methylamino]-2-oxoethyl]-2-phenylacetamide
N-[2-[[2-(3,4-dichloroanilino)-2-oxoethyl]-methylamino]-2-oxoethyl]-2-phenylacetamide (PubChem CID 7999091) has the molecular formula C19H19Cl2N3O3
and a molecular weight of 408.29 g/mol. Its IUPAC name is N-[2-[[2-(3,4-dichloroanilino)-2-oxoethyl]-methylamino]-2-oxoethyl]-2-phenylacetamide.
Molecular Properties
| Compound Name | N-[2-[[2-(3,4-dichloroanilino)-2-oxoethyl]-methylamino]-2-oxoethyl]-2-phenylacetamide |
| PubChem CID | 7999091 |
| Molecular Formula | C19H19Cl2N3O3 |
| Molecular Weight | 408.29 g/mol |
| Exact Mass | 407.08 |
| IUPAC Name | N-[2-[[2-(3,4-dichloroanilino)-2-oxoethyl]-methylamino]-2-oxoethyl]-2-phenylacetamide |
| SMILES | CN(CC(=O)Nc1ccc(Cl)c(Cl)c1)C(=O)CNC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C19H19Cl2N3O3/c1-24(12-18(26)23-14-7-8-15(20)16(21)10-14)19(27)11-22-17(25)9-13-5-3-2-4-6-13/h2-8,10H,9,11-12H2,1H3,(H,22,25)(H,23,26) |
| InChIKey | LSLYFSHHUCTYRP-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.29 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[2-[[2-(3,4-dichloroanilino)-2-oxoethyl]-methylamino]-2-oxoethyl]-2-phenylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[[2-(3,4-dichloroanilino)-2-oxoethyl]-methylamino]-2-oxoethyl]-2-phenylacetamide?
The IUPAC name of N-[2-[[2-(3,4-dichloroanilino)-2-oxoethyl]-methylamino]-2-oxoethyl]-2-phenylacetamide (CID 7999091) is N-[2-[[2-(3,4-dichloroanilino)-2-oxoethyl]-methylamino]-2-oxoethyl]-2-phenylacetamide.
What is the SMILES notation for N-[2-[[2-(3,4-dichloroanilino)-2-oxoethyl]-methylamino]-2-oxoethyl]-2-phenylacetamide?
The canonical SMILES for N-[2-[[2-(3,4-dichloroanilino)-2-oxoethyl]-methylamino]-2-oxoethyl]-2-phenylacetamide is CN(CC(=O)Nc1ccc(Cl)c(Cl)c1)C(=O)CNC(=O)Cc1ccccc1.
What is the InChIKey of N-[2-[[2-(3,4-dichloroanilino)-2-oxoethyl]-methylamino]-2-oxoethyl]-2-phenylacetamide?
The InChIKey is LSLYFSHHUCTYRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19Cl2N3O3/c1-24(12-18(26)23-14-7-8-15(20)16(21)10-14)19(27)11-22-17(25)9-13-5-3-2-4-6-13/h2-8,10H,9,11-12H2,1H3,(H,22,25)(H,23,26).
What are the key properties of N-[2-[[2-(3,4-dichloroanilino)-2-oxoethyl]-methylamino]-2-oxoethyl]-2-phenylacetamide?
N-[2-[[2-(3,4-dichloroanilino)-2-oxoethyl]-methylamino]-2-oxoethyl]-2-phenylacetamide has a molecular weight of 408.29 g/mol, XLogP of 2.75, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[[2-(3,4-dichloroanilino)-2-oxoethyl]-methylamino]-2-oxoethyl]-2-phenylacetamide is sourced from PubChem (CID 7999091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).