C16H19N3O — CID 79992741
(3-amino-5-methylpiperidin-1-yl)-quinolin-5-ylmethanone (PubChem CID 79992741) has the molecular formula C16H19N3O and a molecular weight of 269.35 g/mol. Its IUPAC name is (3-amino-5-methylpiperidin-1-yl)-quinolin-5-ylmethanone.
| Compound Name | (3-amino-5-methylpiperidin-1-yl)-quinolin-5-ylmethanone |
|---|---|
| PubChem CID | 79992741 |
| Molecular Formula | C16H19N3O |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.15 |
| IUPAC Name | (3-amino-5-methylpiperidin-1-yl)-quinolin-5-ylmethanone |
| SMILES | CC1CC(N)CN(C(=O)c2cccc3ncccc23)C1 |
| InChI | InChI=1S/C16H19N3O/c1-11-8-12(17)10-19(9-11)16(20)14-4-2-6-15-13(14)5-3-7-18-15/h2-7,11-12H,8-10,17H2,1H3 |
| InChIKey | PWZPBSAVFXVXGQ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |