About 2-amino-3,3,3-trifluoro-2-(3-methylthiophen-2-yl)propanoic acid
2-amino-3,3,3-trifluoro-2-(3-methylthiophen-2-yl)propanoic acid (PubChem CID 79995015) has the molecular formula C8H8F3NO2S
and a molecular weight of 239.22 g/mol. Its IUPAC name is 2-amino-3,3,3-trifluoro-2-(3-methylthiophen-2-yl)propanoic acid.
Molecular Properties
| Compound Name | 2-amino-3,3,3-trifluoro-2-(3-methylthiophen-2-yl)propanoic acid |
| PubChem CID | 79995015 |
| Molecular Formula | C8H8F3NO2S |
| Molecular Weight | 239.22 g/mol |
| Exact Mass | 239.02 |
| IUPAC Name | 2-amino-3,3,3-trifluoro-2-(3-methylthiophen-2-yl)propanoic acid |
| SMILES | Cc1ccsc1C(N)(C(=O)O)C(F)(F)F |
| InChI | InChI=1S/C8H8F3NO2S/c1-4-2-3-15-5(4)7(12,6(13)14)8(9,10)11/h2-3H,12H2,1H3,(H,13,14) |
| InChIKey | JFTHQUKMNMELCT-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.22 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-amino-3,3,3-trifluoro-2-(3-methylthiophen-2-yl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3,3,3-trifluoro-2-(3-methylthiophen-2-yl)propanoic acid?
The IUPAC name of 2-amino-3,3,3-trifluoro-2-(3-methylthiophen-2-yl)propanoic acid (CID 79995015) is 2-amino-3,3,3-trifluoro-2-(3-methylthiophen-2-yl)propanoic acid.
What is the SMILES notation for 2-amino-3,3,3-trifluoro-2-(3-methylthiophen-2-yl)propanoic acid?
The canonical SMILES for 2-amino-3,3,3-trifluoro-2-(3-methylthiophen-2-yl)propanoic acid is Cc1ccsc1C(N)(C(=O)O)C(F)(F)F.
What is the InChIKey of 2-amino-3,3,3-trifluoro-2-(3-methylthiophen-2-yl)propanoic acid?
The InChIKey is JFTHQUKMNMELCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8F3NO2S/c1-4-2-3-15-5(4)7(12,6(13)14)8(9,10)11/h2-3H,12H2,1H3,(H,13,14).
What are the key properties of 2-amino-3,3,3-trifluoro-2-(3-methylthiophen-2-yl)propanoic acid?
2-amino-3,3,3-trifluoro-2-(3-methylthiophen-2-yl)propanoic acid has a molecular weight of 239.22 g/mol, XLogP of 1.86, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3,3,3-trifluoro-2-(3-methylthiophen-2-yl)propanoic acid is sourced from PubChem (CID 79995015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).