C20H26O — CID 79995881
(3,5-dimethyl-1-adamantyl)-(2-methylphenyl)methanone (PubChem CID 79995881) has the molecular formula C20H26O and a molecular weight of 282.43 g/mol. Its IUPAC name is (3,5-dimethyl-1-adamantyl)-(2-methylphenyl)methanone.
| Compound Name | (3,5-dimethyl-1-adamantyl)-(2-methylphenyl)methanone |
|---|---|
| PubChem CID | 79995881 |
| Molecular Formula | C20H26O |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.20 |
| IUPAC Name | (3,5-dimethyl-1-adamantyl)-(2-methylphenyl)methanone |
| SMILES | Cc1ccccc1C(=O)C12CC3CC(C)(CC(C)(C3)C1)C2 |
| InChI | InChI=1S/C20H26O/c1-14-6-4-5-7-16(14)17(21)20-10-15-8-18(2,12-20)11-19(3,9-15)13-20/h4-7,15H,8-13H2,1-3H3 |
| InChIKey | ZMUOKQAGRXCSEZ-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |