About 1-(3,5-dimethyl-1-adamantyl)-N-propylpent-4-yn-1-amine
1-(3,5-dimethyl-1-adamantyl)-N-propylpent-4-yn-1-amine (PubChem CID 79996178) has the molecular formula C20H33N
and a molecular weight of 287.49 g/mol. Its IUPAC name is 1-(3,5-dimethyl-1-adamantyl)-N-propylpent-4-yn-1-amine.
Molecular Properties
| Compound Name | 1-(3,5-dimethyl-1-adamantyl)-N-propylpent-4-yn-1-amine |
| PubChem CID | 79996178 |
| Molecular Formula | C20H33N |
| Molecular Weight | 287.49 g/mol |
| Exact Mass | 287.26 |
| IUPAC Name | 1-(3,5-dimethyl-1-adamantyl)-N-propylpent-4-yn-1-amine |
| SMILES | C#CCCC(NCCC)C12CC3CC(C)(CC(C)(C3)C1)C2 |
| InChI | InChI=1S/C20H33N/c1-5-7-8-17(21-9-6-2)20-12-16-10-18(3,14-20)13-19(4,11-16)15-20/h1,16-17,21H,6-15H2,2-4H3 |
| InChIKey | PCGFPUQOFVIWTR-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.49 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(3,5-dimethyl-1-adamantyl)-N-propylpent-4-yn-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,5-dimethyl-1-adamantyl)-N-propylpent-4-yn-1-amine?
The IUPAC name of 1-(3,5-dimethyl-1-adamantyl)-N-propylpent-4-yn-1-amine (CID 79996178) is 1-(3,5-dimethyl-1-adamantyl)-N-propylpent-4-yn-1-amine.
What is the SMILES notation for 1-(3,5-dimethyl-1-adamantyl)-N-propylpent-4-yn-1-amine?
The canonical SMILES for 1-(3,5-dimethyl-1-adamantyl)-N-propylpent-4-yn-1-amine is C#CCCC(NCCC)C12CC3CC(C)(CC(C)(C3)C1)C2.
What is the InChIKey of 1-(3,5-dimethyl-1-adamantyl)-N-propylpent-4-yn-1-amine?
The InChIKey is PCGFPUQOFVIWTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H33N/c1-5-7-8-17(21-9-6-2)20-12-16-10-18(3,14-20)13-19(4,11-16)15-20/h1,16-17,21H,6-15H2,2-4H3.
What are the key properties of 1-(3,5-dimethyl-1-adamantyl)-N-propylpent-4-yn-1-amine?
1-(3,5-dimethyl-1-adamantyl)-N-propylpent-4-yn-1-amine has a molecular weight of 287.49 g/mol, XLogP of 4.76, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,5-dimethyl-1-adamantyl)-N-propylpent-4-yn-1-amine is sourced from PubChem (CID 79996178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).