C15H22N4O — CID 79996226
2-[[methyl-(1-methylpiperidin-4-yl)amino]methyl]-1,3-benzoxazol-4-amine (PubChem CID 79996226) has the molecular formula C15H22N4O and a molecular weight of 274.37 g/mol. Its IUPAC name is 2-[[methyl-(1-methylpiperidin-4-yl)amino]methyl]-1,3-benzoxazol-4-amine.
| Compound Name | 2-[[methyl-(1-methylpiperidin-4-yl)amino]methyl]-1,3-benzoxazol-4-amine |
|---|---|
| PubChem CID | 79996226 |
| Molecular Formula | C15H22N4O |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | 2-[[methyl-(1-methylpiperidin-4-yl)amino]methyl]-1,3-benzoxazol-4-amine |
| SMILES | CN1CCC(N(C)Cc2nc3c(N)cccc3o2)CC1 |
| InChI | InChI=1S/C15H22N4O/c1-18-8-6-11(7-9-18)19(2)10-14-17-15-12(16)4-3-5-13(15)20-14/h3-5,11H,6-10,16H2,1-2H3 |
| InChIKey | VIIJACPJUAAKMF-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|