C11H13BrN4S — CID 79996329
3-(5-bromo-4-methylthiophen-2-yl)-8-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine (PubChem CID 79996329) has the molecular formula C11H13BrN4S and a molecular weight of 313.22 g/mol. Its IUPAC name is 3-(5-bromo-4-methylthiophen-2-yl)-8-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine.
| Compound Name | 3-(5-bromo-4-methylthiophen-2-yl)-8-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine |
|---|---|
| PubChem CID | 79996329 |
| Molecular Formula | C11H13BrN4S |
| Molecular Weight | 313.22 g/mol |
| Exact Mass | 312.00 |
| IUPAC Name | 3-(5-bromo-4-methylthiophen-2-yl)-8-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine |
| SMILES | Cc1cc(-c2nnc3n2CCNC3C)sc1Br |
| InChI | InChI=1S/C11H13BrN4S/c1-6-5-8(17-9(6)12)11-15-14-10-7(2)13-3-4-16(10)11/h5,7,13H,3-4H2,1-2H3 |
| InChIKey | FBHXNYWZGQMMIH-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.22 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |