About 1-[(3,5-dimethyl-1-adamantyl)amino]propan-2-ol
1-[(3,5-dimethyl-1-adamantyl)amino]propan-2-ol (PubChem CID 79997666) has the molecular formula C15H27NO
and a molecular weight of 237.39 g/mol. Its IUPAC name is 1-[(3,5-dimethyl-1-adamantyl)amino]propan-2-ol.
Molecular Properties
| Compound Name | 1-[(3,5-dimethyl-1-adamantyl)amino]propan-2-ol |
| PubChem CID | 79997666 |
| Molecular Formula | C15H27NO |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.21 |
| IUPAC Name | 1-[(3,5-dimethyl-1-adamantyl)amino]propan-2-ol |
| SMILES | CC(O)CNC12CC3CC(C)(CC(C)(C3)C1)C2 |
| InChI | InChI=1S/C15H27NO/c1-11(17)7-16-15-6-12-4-13(2,9-15)8-14(3,5-12)10-15/h11-12,16-17H,4-10H2,1-3H3 |
| InChIKey | ZBJYRHOOVARHOZ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[(3,5-dimethyl-1-adamantyl)amino]propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3,5-dimethyl-1-adamantyl)amino]propan-2-ol?
The IUPAC name of 1-[(3,5-dimethyl-1-adamantyl)amino]propan-2-ol (CID 79997666) is 1-[(3,5-dimethyl-1-adamantyl)amino]propan-2-ol.
What is the SMILES notation for 1-[(3,5-dimethyl-1-adamantyl)amino]propan-2-ol?
The canonical SMILES for 1-[(3,5-dimethyl-1-adamantyl)amino]propan-2-ol is CC(O)CNC12CC3CC(C)(CC(C)(C3)C1)C2.
What is the InChIKey of 1-[(3,5-dimethyl-1-adamantyl)amino]propan-2-ol?
The InChIKey is ZBJYRHOOVARHOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H27NO/c1-11(17)7-16-15-6-12-4-13(2,9-15)8-14(3,5-12)10-15/h11-12,16-17H,4-10H2,1-3H3.
What are the key properties of 1-[(3,5-dimethyl-1-adamantyl)amino]propan-2-ol?
1-[(3,5-dimethyl-1-adamantyl)amino]propan-2-ol has a molecular weight of 237.39 g/mol, XLogP of 2.71, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3,5-dimethyl-1-adamantyl)amino]propan-2-ol is sourced from PubChem (CID 79997666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).