C13H18BrNO4S2 — CID 79997730
1-(5-bromo-4-methylthiophen-2-yl)sulfonyl-4-ethylpiperidine-4-carboxylic acid (PubChem CID 79997730) has the molecular formula C13H18BrNO4S2 and a molecular weight of 396.33 g/mol. Its IUPAC name is 1-(5-bromo-4-methylthiophen-2-yl)sulfonyl-4-ethylpiperidine-4-carboxylic acid.
| Compound Name | 1-(5-bromo-4-methylthiophen-2-yl)sulfonyl-4-ethylpiperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 79997730 |
| Molecular Formula | C13H18BrNO4S2 |
| Molecular Weight | 396.33 g/mol |
| Exact Mass | 394.99 |
| IUPAC Name | 1-(5-bromo-4-methylthiophen-2-yl)sulfonyl-4-ethylpiperidine-4-carboxylic acid |
| SMILES | CCC1(C(=O)O)CCN(S(=O)(=O)c2cc(C)c(Br)s2)CC1 |
| InChI | InChI=1S/C13H18BrNO4S2/c1-3-13(12(16)17)4-6-15(7-5-13)21(18,19)10-8-9(2)11(14)20-10/h8H,3-7H2,1-2H3,(H,16,17) |
| InChIKey | YBCHYWDIGGHCLM-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.33 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |