About N-(2,3-dichloroprop-2-enyl)-3,5-dimethyladamantan-1-amine
N-(2,3-dichloroprop-2-enyl)-3,5-dimethyladamantan-1-amine (PubChem CID 79997830) has the molecular formula C15H23Cl2N
and a molecular weight of 288.26 g/mol. Its IUPAC name is N-(2,3-dichloroprop-2-enyl)-3,5-dimethyladamantan-1-amine.
Molecular Properties
| Compound Name | N-(2,3-dichloroprop-2-enyl)-3,5-dimethyladamantan-1-amine |
| PubChem CID | 79997830 |
| Molecular Formula | C15H23Cl2N |
| Molecular Weight | 288.26 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | N-(2,3-dichloroprop-2-enyl)-3,5-dimethyladamantan-1-amine |
| SMILES | CC12CC3CC(C)(C1)CC(NCC(Cl)=CCl)(C3)C2 |
| InChI | InChI=1S/C15H23Cl2N/c1-13-3-11-4-14(2,8-13)10-15(5-11,9-13)18-7-12(17)6-16/h6,11,18H,3-5,7-10H2,1-2H3 |
| InChIKey | YWMVASVGVSNBES-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.26 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-(2,3-dichloroprop-2-enyl)-3,5-dimethyladamantan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,3-dichloroprop-2-enyl)-3,5-dimethyladamantan-1-amine?
The IUPAC name of N-(2,3-dichloroprop-2-enyl)-3,5-dimethyladamantan-1-amine (CID 79997830) is N-(2,3-dichloroprop-2-enyl)-3,5-dimethyladamantan-1-amine.
What is the SMILES notation for N-(2,3-dichloroprop-2-enyl)-3,5-dimethyladamantan-1-amine?
The canonical SMILES for N-(2,3-dichloroprop-2-enyl)-3,5-dimethyladamantan-1-amine is CC12CC3CC(C)(C1)CC(NCC(Cl)=CCl)(C3)C2.
What is the InChIKey of N-(2,3-dichloroprop-2-enyl)-3,5-dimethyladamantan-1-amine?
The InChIKey is YWMVASVGVSNBES-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23Cl2N/c1-13-3-11-4-14(2,8-13)10-15(5-11,9-13)18-7-12(17)6-16/h6,11,18H,3-5,7-10H2,1-2H3.
What are the key properties of N-(2,3-dichloroprop-2-enyl)-3,5-dimethyladamantan-1-amine?
N-(2,3-dichloroprop-2-enyl)-3,5-dimethyladamantan-1-amine has a molecular weight of 288.26 g/mol, XLogP of 4.64, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,3-dichloroprop-2-enyl)-3,5-dimethyladamantan-1-amine is sourced from PubChem (CID 79997830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).