C15H24F3NO — CID 79998041
3-[(3,5-dimethyl-1-adamantyl)amino]-1,1,1-trifluoropropan-2-ol (PubChem CID 79998041) has the molecular formula C15H24F3NO and a molecular weight of 291.36 g/mol. Its IUPAC name is 3-[(3,5-dimethyl-1-adamantyl)amino]-1,1,1-trifluoropropan-2-ol.
| Compound Name | 3-[(3,5-dimethyl-1-adamantyl)amino]-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 79998041 |
| Molecular Formula | C15H24F3NO |
| Molecular Weight | 291.36 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | 3-[(3,5-dimethyl-1-adamantyl)amino]-1,1,1-trifluoropropan-2-ol |
| SMILES | CC12CC3CC(C)(C1)CC(NCC(O)C(F)(F)F)(C3)C2 |
| InChI | InChI=1S/C15H24F3NO/c1-12-3-10-4-13(2,7-12)9-14(5-10,8-12)19-6-11(20)15(16,17)18/h10-11,19-20H,3-9H2,1-2H3 |
| InChIKey | RHMHBHQZWKWGSZ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.36 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |