C15H17N3OS2 — CID 79998077
5-(3-aminoprop-1-ynyl)-4-methyl-N-(4-propan-2-yl-1,3-thiazol-2-yl)thiophene-2-carboxamide (PubChem CID 79998077) has the molecular formula C15H17N3OS2 and a molecular weight of 319.46 g/mol. Its IUPAC name is 5-(3-aminoprop-1-ynyl)-4-methyl-N-(4-propan-2-yl-1,3-thiazol-2-yl)thiophene-2-carboxamide.
| Compound Name | 5-(3-aminoprop-1-ynyl)-4-methyl-N-(4-propan-2-yl-1,3-thiazol-2-yl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 79998077 |
| Molecular Formula | C15H17N3OS2 |
| Molecular Weight | 319.46 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | 5-(3-aminoprop-1-ynyl)-4-methyl-N-(4-propan-2-yl-1,3-thiazol-2-yl)thiophene-2-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2nc(C(C)C)cs2)sc1C#CCN |
| InChI | InChI=1S/C15H17N3OS2/c1-9(2)11-8-20-15(17-11)18-14(19)13-7-10(3)12(21-13)5-4-6-16/h7-9H,6,16H2,1-3H3,(H,17,18,19) |
| InChIKey | HJVATTMROUMOIK-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.46 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|