About 4-(4-methyl-1,4-diazepan-4-ium-1-yl)thieno[2,3-d]pyrimidine
4-(4-methyl-1,4-diazepan-4-ium-1-yl)thieno[2,3-d]pyrimidine (PubChem CID 7999823) has the molecular formula C12H17N4S+
and a molecular weight of 249.36 g/mol. Its IUPAC name is 4-(4-methyl-1,4-diazepan-4-ium-1-yl)thieno[2,3-d]pyrimidine.
Molecular Properties
| Compound Name | 4-(4-methyl-1,4-diazepan-4-ium-1-yl)thieno[2,3-d]pyrimidine |
| PubChem CID | 7999823 |
| Molecular Formula | C12H17N4S+ |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | 4-(4-methyl-1,4-diazepan-4-ium-1-yl)thieno[2,3-d]pyrimidine |
| SMILES | C[NH+]1CCCN(c2ncnc3sccc23)CC1 |
| InChI | InChI=1S/C12H16N4S/c1-15-4-2-5-16(7-6-15)11-10-3-8-17-12(10)14-9-13-11/h3,8-9H,2,4-7H2,1H3/p+1 |
| InChIKey | GMZJCSNOQWCVGY-UHFFFAOYSA-O |
| XLogP | 0.42 |
| TPSA | 33.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(4-methyl-1,4-diazepan-4-ium-1-yl)thieno[2,3-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-methyl-1,4-diazepan-4-ium-1-yl)thieno[2,3-d]pyrimidine?
The IUPAC name of 4-(4-methyl-1,4-diazepan-4-ium-1-yl)thieno[2,3-d]pyrimidine (CID 7999823) is 4-(4-methyl-1,4-diazepan-4-ium-1-yl)thieno[2,3-d]pyrimidine.
What is the SMILES notation for 4-(4-methyl-1,4-diazepan-4-ium-1-yl)thieno[2,3-d]pyrimidine?
The canonical SMILES for 4-(4-methyl-1,4-diazepan-4-ium-1-yl)thieno[2,3-d]pyrimidine is C[NH+]1CCCN(c2ncnc3sccc23)CC1.
What is the InChIKey of 4-(4-methyl-1,4-diazepan-4-ium-1-yl)thieno[2,3-d]pyrimidine?
The InChIKey is GMZJCSNOQWCVGY-UHFFFAOYSA-O. The full InChI is InChI=1S/C12H16N4S/c1-15-4-2-5-16(7-6-15)11-10-3-8-17-12(10)14-9-13-11/h3,8-9H,2,4-7H2,1H3/p+1.
What are the key properties of 4-(4-methyl-1,4-diazepan-4-ium-1-yl)thieno[2,3-d]pyrimidine?
4-(4-methyl-1,4-diazepan-4-ium-1-yl)thieno[2,3-d]pyrimidine has a molecular weight of 249.36 g/mol, XLogP of 0.42, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-methyl-1,4-diazepan-4-ium-1-yl)thieno[2,3-d]pyrimidine is sourced from PubChem (CID 7999823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).