C13H13BrN2O3S2 — CID 79998270
5-bromo-4-methyl-N-[2-(methylsulfamoyl)phenyl]thiophene-2-carboxamide (PubChem CID 79998270) has the molecular formula C13H13BrN2O3S2 and a molecular weight of 389.30 g/mol. Its IUPAC name is 5-bromo-4-methyl-N-[2-(methylsulfamoyl)phenyl]thiophene-2-carboxamide.
| Compound Name | 5-bromo-4-methyl-N-[2-(methylsulfamoyl)phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 79998270 |
| Molecular Formula | C13H13BrN2O3S2 |
| Molecular Weight | 389.30 g/mol |
| Exact Mass | 387.96 |
| IUPAC Name | 5-bromo-4-methyl-N-[2-(methylsulfamoyl)phenyl]thiophene-2-carboxamide |
| SMILES | CNS(=O)(=O)c1ccccc1NC(=O)c1cc(C)c(Br)s1 |
| InChI | InChI=1S/C13H13BrN2O3S2/c1-8-7-10(20-12(8)14)13(17)16-9-5-3-4-6-11(9)21(18,19)15-2/h3-7,15H,1-2H3,(H,16,17) |
| InChIKey | ROOKLSMSLQUBBH-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.30 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |