About 4-[2-chloro-2-(3,5-dimethyl-1-adamantyl)ethyl]pyridine
4-[2-chloro-2-(3,5-dimethyl-1-adamantyl)ethyl]pyridine (PubChem CID 79998455) has the molecular formula C19H26ClN
and a molecular weight of 303.88 g/mol. Its IUPAC name is 4-[2-chloro-2-(3,5-dimethyl-1-adamantyl)ethyl]pyridine.
Molecular Properties
| Compound Name | 4-[2-chloro-2-(3,5-dimethyl-1-adamantyl)ethyl]pyridine |
| PubChem CID | 79998455 |
| Molecular Formula | C19H26ClN |
| Molecular Weight | 303.88 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | 4-[2-chloro-2-(3,5-dimethyl-1-adamantyl)ethyl]pyridine |
| SMILES | CC12CC3CC(C)(C1)CC(C(Cl)Cc1ccncc1)(C3)C2 |
| InChI | InChI=1S/C19H26ClN/c1-17-8-15-9-18(2,11-17)13-19(10-15,12-17)16(20)7-14-3-5-21-6-4-14/h3-6,15-16H,7-13H2,1-2H3 |
| InChIKey | BRNVJIMOEAJAMS-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 303.88 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-chloro-2-(3,5-dimethyl-1-adamantyl)ethyl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-chloro-2-(3,5-dimethyl-1-adamantyl)ethyl]pyridine?
The IUPAC name of 4-[2-chloro-2-(3,5-dimethyl-1-adamantyl)ethyl]pyridine (CID 79998455) is 4-[2-chloro-2-(3,5-dimethyl-1-adamantyl)ethyl]pyridine.
What is the SMILES notation for 4-[2-chloro-2-(3,5-dimethyl-1-adamantyl)ethyl]pyridine?
The canonical SMILES for 4-[2-chloro-2-(3,5-dimethyl-1-adamantyl)ethyl]pyridine is CC12CC3CC(C)(C1)CC(C(Cl)Cc1ccncc1)(C3)C2.
What is the InChIKey of 4-[2-chloro-2-(3,5-dimethyl-1-adamantyl)ethyl]pyridine?
The InChIKey is BRNVJIMOEAJAMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H26ClN/c1-17-8-15-9-18(2,11-17)13-19(10-15,12-17)16(20)7-14-3-5-21-6-4-14/h3-6,15-16H,7-13H2,1-2H3.
What are the key properties of 4-[2-chloro-2-(3,5-dimethyl-1-adamantyl)ethyl]pyridine?
4-[2-chloro-2-(3,5-dimethyl-1-adamantyl)ethyl]pyridine has a molecular weight of 303.88 g/mol, XLogP of 5.23, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-chloro-2-(3,5-dimethyl-1-adamantyl)ethyl]pyridine is sourced from PubChem (CID 79998455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).