About 2-(1-chloroethyl)-5-(3,5-dimethyl-1-adamantyl)-1,3-oxazole
2-(1-chloroethyl)-5-(3,5-dimethyl-1-adamantyl)-1,3-oxazole (PubChem CID 79998687) has the molecular formula C17H24ClNO
and a molecular weight of 293.84 g/mol. Its IUPAC name is 2-(1-chloroethyl)-5-(3,5-dimethyl-1-adamantyl)-1,3-oxazole.
Molecular Properties
| Compound Name | 2-(1-chloroethyl)-5-(3,5-dimethyl-1-adamantyl)-1,3-oxazole |
| PubChem CID | 79998687 |
| Molecular Formula | C17H24ClNO |
| Molecular Weight | 293.84 g/mol |
| Exact Mass | 293.15 |
| IUPAC Name | 2-(1-chloroethyl)-5-(3,5-dimethyl-1-adamantyl)-1,3-oxazole |
| SMILES | CC(Cl)c1ncc(C23CC4CC(C)(CC(C)(C4)C2)C3)o1 |
| InChI | InChI=1S/C17H24ClNO/c1-11(18)14-19-7-13(20-14)17-6-12-4-15(2,9-17)8-16(3,5-12)10-17/h7,11-12H,4-6,8-10H2,1-3H3 |
| InChIKey | QPEYIDABMDOTPQ-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 293.84 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-chloroethyl)-5-(3,5-dimethyl-1-adamantyl)-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-chloroethyl)-5-(3,5-dimethyl-1-adamantyl)-1,3-oxazole?
The IUPAC name of 2-(1-chloroethyl)-5-(3,5-dimethyl-1-adamantyl)-1,3-oxazole (CID 79998687) is 2-(1-chloroethyl)-5-(3,5-dimethyl-1-adamantyl)-1,3-oxazole.
What is the SMILES notation for 2-(1-chloroethyl)-5-(3,5-dimethyl-1-adamantyl)-1,3-oxazole?
The canonical SMILES for 2-(1-chloroethyl)-5-(3,5-dimethyl-1-adamantyl)-1,3-oxazole is CC(Cl)c1ncc(C23CC4CC(C)(CC(C)(C4)C2)C3)o1.
What is the InChIKey of 2-(1-chloroethyl)-5-(3,5-dimethyl-1-adamantyl)-1,3-oxazole?
The InChIKey is QPEYIDABMDOTPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24ClNO/c1-11(18)14-19-7-13(20-14)17-6-12-4-15(2,9-17)8-16(3,5-12)10-17/h7,11-12H,4-6,8-10H2,1-3H3.
What are the key properties of 2-(1-chloroethyl)-5-(3,5-dimethyl-1-adamantyl)-1,3-oxazole?
2-(1-chloroethyl)-5-(3,5-dimethyl-1-adamantyl)-1,3-oxazole has a molecular weight of 293.84 g/mol, XLogP of 5.22, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-chloroethyl)-5-(3,5-dimethyl-1-adamantyl)-1,3-oxazole is sourced from PubChem (CID 79998687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).