C14H11ClN2O2 — CID 79998838
2-[(3-chlorophenoxy)methyl]-1,3-benzoxazol-4-amine (PubChem CID 79998838) has the molecular formula C14H11ClN2O2 and a molecular weight of 274.71 g/mol. Its IUPAC name is 2-[(3-chlorophenoxy)methyl]-1,3-benzoxazol-4-amine.
| Compound Name | 2-[(3-chlorophenoxy)methyl]-1,3-benzoxazol-4-amine |
|---|---|
| PubChem CID | 79998838 |
| Molecular Formula | C14H11ClN2O2 |
| Molecular Weight | 274.71 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | 2-[(3-chlorophenoxy)methyl]-1,3-benzoxazol-4-amine |
| SMILES | Nc1cccc2oc(COc3cccc(Cl)c3)nc12 |
| InChI | InChI=1S/C14H11ClN2O2/c15-9-3-1-4-10(7-9)18-8-13-17-14-11(16)5-2-6-12(14)19-13/h1-7H,8,16H2 |
| InChIKey | XKYQVAWGIGXUGH-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.71 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|