About 1-[chloro-(4-methylphenyl)methyl]-3,5-dimethyladamantane
1-[chloro-(4-methylphenyl)methyl]-3,5-dimethyladamantane (PubChem CID 79998908) has the molecular formula C20H27Cl
and a molecular weight of 302.89 g/mol. Its IUPAC name is 1-[chloro-(4-methylphenyl)methyl]-3,5-dimethyladamantane.
Molecular Properties
| Compound Name | 1-[chloro-(4-methylphenyl)methyl]-3,5-dimethyladamantane |
| PubChem CID | 79998908 |
| Molecular Formula | C20H27Cl |
| Molecular Weight | 302.89 g/mol |
| Exact Mass | 302.18 |
| IUPAC Name | 1-[chloro-(4-methylphenyl)methyl]-3,5-dimethyladamantane |
| SMILES | Cc1ccc(C(Cl)C23CC4CC(C)(CC(C)(C4)C2)C3)cc1 |
| InChI | InChI=1S/C20H27Cl/c1-14-4-6-16(7-5-14)17(21)20-10-15-8-18(2,12-20)11-19(3,9-15)13-20/h4-7,15,17H,8-13H2,1-3H3 |
| InChIKey | LWDCDIIIIUOFGE-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 302.89 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-[chloro-(4-methylphenyl)methyl]-3,5-dimethyladamantane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[chloro-(4-methylphenyl)methyl]-3,5-dimethyladamantane?
The IUPAC name of 1-[chloro-(4-methylphenyl)methyl]-3,5-dimethyladamantane (CID 79998908) is 1-[chloro-(4-methylphenyl)methyl]-3,5-dimethyladamantane.
What is the SMILES notation for 1-[chloro-(4-methylphenyl)methyl]-3,5-dimethyladamantane?
The canonical SMILES for 1-[chloro-(4-methylphenyl)methyl]-3,5-dimethyladamantane is Cc1ccc(C(Cl)C23CC4CC(C)(CC(C)(C4)C2)C3)cc1.
What is the InChIKey of 1-[chloro-(4-methylphenyl)methyl]-3,5-dimethyladamantane?
The InChIKey is LWDCDIIIIUOFGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H27Cl/c1-14-4-6-16(7-5-14)17(21)20-10-15-8-18(2,12-20)11-19(3,9-15)13-20/h4-7,15,17H,8-13H2,1-3H3.
What are the key properties of 1-[chloro-(4-methylphenyl)methyl]-3,5-dimethyladamantane?
1-[chloro-(4-methylphenyl)methyl]-3,5-dimethyladamantane has a molecular weight of 302.89 g/mol, XLogP of 6.27, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[chloro-(4-methylphenyl)methyl]-3,5-dimethyladamantane is sourced from PubChem (CID 79998908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).