C15H23N3OS — CID 799997
N-(3,5-dimethylphenyl)-N'-[2-(4-morpholinyl)ethyl]thiourea (PubChem CID 799997) has the molecular formula C15H23N3OS and a molecular weight of 293.40 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-3-(2-morpholin-4-ylethyl)thiourea.
| Compound Name | N-(3,5-dimethylphenyl)-N'-[2-(4-morpholinyl)ethyl]thiourea |
|---|---|
| PubChem CID | 799997 |
| Molecular Formula | C15H23N3OS |
| Molecular Weight | 293.40 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-3-(2-morpholin-4-ylethyl)thiourea |
| SMILES | CC1=CC(=CC(=C1)NC(=S)NCCN2CCOCC2)C |
| InChI | InChI=1S/C15H23N3OS/c1-12-9-13(2)11-14(10-12)17-15(20)16-3-4-18-5-7-19-8-6-18/h9-11H,3-8H2,1-2H3,(H2,16,17,20) |
| InChIKey | PHUXOAYQALWRDJ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 68.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | 297 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.40 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|