C16H14N4O — CID 79999856
4-[(4-amino-1,3-benzoxazol-2-yl)methyl-methylamino]benzonitrile (PubChem CID 79999856) has the molecular formula C16H14N4O and a molecular weight of 278.32 g/mol. Its IUPAC name is 4-[(4-amino-1,3-benzoxazol-2-yl)methyl-methylamino]benzonitrile.
| Compound Name | 4-[(4-amino-1,3-benzoxazol-2-yl)methyl-methylamino]benzonitrile |
|---|---|
| PubChem CID | 79999856 |
| Molecular Formula | C16H14N4O |
| Molecular Weight | 278.32 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 4-[(4-amino-1,3-benzoxazol-2-yl)methyl-methylamino]benzonitrile |
| SMILES | CN(Cc1nc2c(N)cccc2o1)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C16H14N4O/c1-20(12-7-5-11(9-17)6-8-12)10-15-19-16-13(18)3-2-4-14(16)21-15/h2-8H,10,18H2,1H3 |
| InChIKey | DFUIANJAIKBDHM-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 79.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.32 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|