About 9H-fluoren-9-yl-[(1R,2S)-2-methylcyclohexyl]azanium
9H-fluoren-9-yl-[(1R,2S)-2-methylcyclohexyl]azanium (PubChem CID 8000704) has the molecular formula C20H24N+
and a molecular weight of 278.42 g/mol. Its IUPAC name is 9H-fluoren-9-yl-[(1R,2S)-2-methylcyclohexyl]azanium.
Molecular Properties
| Compound Name | 9H-fluoren-9-yl-[(1R,2S)-2-methylcyclohexyl]azanium |
| PubChem CID | 8000704 |
| Molecular Formula | C20H24N+ |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | 9H-fluoren-9-yl-[(1R,2S)-2-methylcyclohexyl]azanium |
| SMILES | C[C@H]1CCCC[C@H]1[NH2+]C1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C20H23N/c1-14-8-2-7-13-19(14)21-20-17-11-5-3-9-15(17)16-10-4-6-12-18(16)20/h3-6,9-12,14,19-21H,2,7-8,13H2,1H3/p+1/t14-,19+/m0/s1 |
| InChIKey | MKQHVISXGKCEAB-IFXJQAMLSA-O |
| XLogP | 3.90 |
| TPSA | 16.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 9H-fluoren-9-yl-[(1R,2S)-2-methylcyclohexyl]azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9H-fluoren-9-yl-[(1R,2S)-2-methylcyclohexyl]azanium?
The IUPAC name of 9H-fluoren-9-yl-[(1R,2S)-2-methylcyclohexyl]azanium (CID 8000704) is 9H-fluoren-9-yl-[(1R,2S)-2-methylcyclohexyl]azanium.
What is the SMILES notation for 9H-fluoren-9-yl-[(1R,2S)-2-methylcyclohexyl]azanium?
The canonical SMILES for 9H-fluoren-9-yl-[(1R,2S)-2-methylcyclohexyl]azanium is C[C@H]1CCCC[C@H]1[NH2+]C1c2ccccc2-c2ccccc21.
What is the InChIKey of 9H-fluoren-9-yl-[(1R,2S)-2-methylcyclohexyl]azanium?
The InChIKey is MKQHVISXGKCEAB-IFXJQAMLSA-O. The full InChI is InChI=1S/C20H23N/c1-14-8-2-7-13-19(14)21-20-17-11-5-3-9-15(17)16-10-4-6-12-18(16)20/h3-6,9-12,14,19-21H,2,7-8,13H2,1H3/p+1/t14-,19+/m0/s1.
What are the key properties of 9H-fluoren-9-yl-[(1R,2S)-2-methylcyclohexyl]azanium?
9H-fluoren-9-yl-[(1R,2S)-2-methylcyclohexyl]azanium has a molecular weight of 278.42 g/mol, XLogP of 3.90, 2 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 9H-fluoren-9-yl-[(1R,2S)-2-methylcyclohexyl]azanium is sourced from PubChem (CID 8000704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).